C12H15N3OS2 — CID 113489297
2-N-(1,4-dithian-2-ylmethyl)-1,3-benzoxazole-2,5-diamine (PubChem CID 113489297) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is 2-N-(1,4-dithian-2-ylmethyl)-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-(1,4-dithian-2-ylmethyl)-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 113489297 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-N-(1,4-dithian-2-ylmethyl)-1,3-benzoxazole-2,5-diamine |
| SMILES | Nc1ccc2oc(NCC3CSCCS3)nc2c1 |
| InChI | InChI=1S/C12H15N3OS2/c13-8-1-2-11-10(5-8)15-12(16-11)14-6-9-7-17-3-4-18-9/h1-2,5,9H,3-4,6-7,13H2,(H,14,15) |
| InChIKey | AADGODHUYSHQFE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|