C10H11F2N3O2 — CID 114152950
3-[(5-amino-1,3-benzoxazol-2-yl)amino]-2,2-difluoropropan-1-ol (PubChem CID 114152950) has the molecular formula C10H11F2N3O2 and a molecular weight of 243.21 g/mol. Its IUPAC name is 3-[(5-amino-1,3-benzoxazol-2-yl)amino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(5-amino-1,3-benzoxazol-2-yl)amino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 114152950 |
| Molecular Formula | C10H11F2N3O2 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 3-[(5-amino-1,3-benzoxazol-2-yl)amino]-2,2-difluoropropan-1-ol |
| SMILES | Nc1ccc2oc(NCC(F)(F)CO)nc2c1 |
| InChI | InChI=1S/C10H11F2N3O2/c11-10(12,5-16)4-14-9-15-7-3-6(13)1-2-8(7)17-9/h1-3,16H,4-5,13H2,(H,14,15) |
| InChIKey | MSUGSCRTCMCOQC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|