C14H22N4O — CID 79885011
2-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-benzoxazole-2,5-diamine (PubChem CID 79885011) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 79885011 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-benzoxazole-2,5-diamine |
| SMILES | CN(C)CC(C)(C)CNc1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C14H22N4O/c1-14(2,9-18(3)4)8-16-13-17-11-7-10(15)5-6-12(11)19-13/h5-7H,8-9,15H2,1-4H3,(H,16,17) |
| InChIKey | VZNADZWPUYXWTC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|