C13H19N3O2 — CID 107844096
6-[(5-amino-1,3-benzoxazol-2-yl)amino]hexan-1-ol (PubChem CID 107844096) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 6-[(5-amino-1,3-benzoxazol-2-yl)amino]hexan-1-ol.
| Compound Name | 6-[(5-amino-1,3-benzoxazol-2-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 107844096 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 6-[(5-amino-1,3-benzoxazol-2-yl)amino]hexan-1-ol |
| SMILES | Nc1ccc2oc(NCCCCCCO)nc2c1 |
| InChI | InChI=1S/C13H19N3O2/c14-10-5-6-12-11(9-10)16-13(18-12)15-7-3-1-2-4-8-17/h5-6,9,17H,1-4,7-8,14H2,(H,15,16) |
| InChIKey | OAYYIDOLSBHXPZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|