C12H17N3O3 — CID 106308929
2-[3-[(5-amino-1,3-benzoxazol-2-yl)amino]propoxy]ethanol (PubChem CID 106308929) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-[3-[(5-amino-1,3-benzoxazol-2-yl)amino]propoxy]ethanol.
| Compound Name | 2-[3-[(5-amino-1,3-benzoxazol-2-yl)amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106308929 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[3-[(5-amino-1,3-benzoxazol-2-yl)amino]propoxy]ethanol |
| SMILES | Nc1ccc2oc(NCCCOCCO)nc2c1 |
| InChI | InChI=1S/C12H17N3O3/c13-9-2-3-11-10(8-9)15-12(18-11)14-4-1-6-17-7-5-16/h2-3,8,16H,1,4-7,13H2,(H,14,15) |
| InChIKey | ZZOBBQCVICAKPV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|