C15H19N3O — CID 79890367
2-N-(2,2-dicyclopropylethyl)-1,3-benzoxazole-2,5-diamine (PubChem CID 79890367) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-N-(2,2-dicyclopropylethyl)-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-(2,2-dicyclopropylethyl)-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 79890367 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-N-(2,2-dicyclopropylethyl)-1,3-benzoxazole-2,5-diamine |
| SMILES | Nc1ccc2oc(NCC(C3CC3)C3CC3)nc2c1 |
| InChI | InChI=1S/C15H19N3O/c16-11-5-6-14-13(7-11)18-15(19-14)17-8-12(9-1-2-9)10-3-4-10/h5-7,9-10,12H,1-4,8,16H2,(H,17,18) |
| InChIKey | ZLCGZTIHWHJAJF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|