C11H13N3OS — CID 103062414
2-N-(thiolan-3-yl)-1,3-benzoxazole-2,5-diamine (PubChem CID 103062414) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-N-(thiolan-3-yl)-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-(thiolan-3-yl)-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 103062414 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-N-(thiolan-3-yl)-1,3-benzoxazole-2,5-diamine |
| SMILES | Nc1ccc2oc(NC3CCSC3)nc2c1 |
| InChI | InChI=1S/C11H13N3OS/c12-7-1-2-10-9(5-7)14-11(15-10)13-8-3-4-16-6-8/h1-2,5,8H,3-4,6,12H2,(H,13,14) |
| InChIKey | QQHAROSTTTXOBH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|