C19H21N3O — CID 45279549
5-(4-aminophenyl)-N-cyclohexyl-1,3-benzoxazol-2-amine (PubChem CID 45279549) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 5-(4-aminophenyl)-N-cyclohexyl-1,3-benzoxazol-2-amine.
| Compound Name | 5-(4-aminophenyl)-N-cyclohexyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 45279549 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 5-(4-aminophenyl)-N-cyclohexyl-1,3-benzoxazol-2-amine |
| SMILES | Nc1ccc(-c2ccc3oc(NC4CCCCC4)nc3c2)cc1 |
| InChI | InChI=1S/C19H21N3O/c20-15-9-6-13(7-10-15)14-8-11-18-17(12-14)22-19(23-18)21-16-4-2-1-3-5-16/h6-12,16H,1-5,20H2,(H,21,22) |
| InChIKey | IMJXLGZVDADUFS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|