C25H29N3O — CID 91427328
5-(2-butan-2-yl-1H-indol-5-yl)-N-cyclohexyl-1,3-benzoxazol-2-amine (PubChem CID 91427328) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 5-(2-butan-2-yl-1H-indol-5-yl)-N-cyclohexyl-1,3-benzoxazol-2-amine.
| Compound Name | 5-(2-butan-2-yl-1H-indol-5-yl)-N-cyclohexyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 91427328 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 5-(2-butan-2-yl-1H-indol-5-yl)-N-cyclohexyl-1,3-benzoxazol-2-amine |
| SMILES | CCC(C)c1cc2cc(-c3ccc4oc(NC5CCCCC5)nc4c3)ccc2[nH]1 |
| InChI | InChI=1S/C25H29N3O/c1-3-16(2)22-15-19-13-17(9-11-21(19)27-22)18-10-12-24-23(14-18)28-25(29-24)26-20-7-5-4-6-8-20/h9-16,20,27H,3-8H2,1-2H3,(H,26,28) |
| InChIKey | IDCCEDIOFRUUPZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |