C22H28N4O — CID 139602311
N-cyclohexyl-5-(3,7-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)-1,3-benzoxazol-2-amine (PubChem CID 139602311) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is N-cyclohexyl-5-(3,7-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)-1,3-benzoxazol-2-amine.
| Compound Name | N-cyclohexyl-5-(3,7-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 139602311 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-cyclohexyl-5-(3,7-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)-1,3-benzoxazol-2-amine |
| SMILES | Cc1c(-c2ccc3oc(NC4CCCCC4)nc3c2)nc2n1CCC(C)C2 |
| InChI | InChI=1S/C22H28N4O/c1-14-10-11-26-15(2)21(25-20(26)12-14)16-8-9-19-18(13-16)24-22(27-19)23-17-6-4-3-5-7-17/h8-9,13-14,17H,3-7,10-12H2,1-2H3,(H,23,24) |
| InChIKey | NZRCLJZQYXVMRY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |