C15H24N4O — CID 79890125
2-N-[4-[methyl(propan-2-yl)amino]butyl]-1,3-benzoxazole-2,5-diamine (PubChem CID 79890125) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-N-[4-[methyl(propan-2-yl)amino]butyl]-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-[4-[methyl(propan-2-yl)amino]butyl]-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 79890125 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-N-[4-[methyl(propan-2-yl)amino]butyl]-1,3-benzoxazole-2,5-diamine |
| SMILES | CC(C)N(C)CCCCNc1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C15H24N4O/c1-11(2)19(3)9-5-4-8-17-15-18-13-10-12(16)6-7-14(13)20-15/h6-7,10-11H,4-5,8-9,16H2,1-3H3,(H,17,18) |
| InChIKey | PMUBRHTWUGWGIA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|