About 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol
1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol (PubChem CID 79890676) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol |
| PubChem CID | 79890676 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol |
| SMILES | CN(CC(C)(C)O)c1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C12H17N3O2/c1-12(2,16)7-15(3)11-14-9-6-8(13)4-5-10(9)17-11/h4-6,16H,7,13H2,1-3H3 |
| InChIKey | IXQBZHVAXISUGU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol?
The IUPAC name of 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol (CID 79890676) is 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol.
What is the SMILES notation for 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol?
The canonical SMILES for 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol is CN(CC(C)(C)O)c1nc2cc(N)ccc2o1.
What is the InChIKey of 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol?
The InChIKey is IXQBZHVAXISUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-12(2,16)7-15(3)11-14-9-6-8(13)4-5-10(9)17-11/h4-6,16H,7,13H2,1-3H3.
What are the key properties of 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol?
1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol has a molecular weight of 235.29 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-amino-1,3-benzoxazol-2-yl)-methylamino]-2-methylpropan-2-ol is sourced from PubChem (CID 79890676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).