C14H11F2N3O — CID 79890874
2-N-[(3,4-difluorophenyl)methyl]-1,3-benzoxazole-2,5-diamine (PubChem CID 79890874) has the molecular formula C14H11F2N3O and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-N-[(3,4-difluorophenyl)methyl]-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-[(3,4-difluorophenyl)methyl]-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 79890874 |
| Molecular Formula | C14H11F2N3O |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-N-[(3,4-difluorophenyl)methyl]-1,3-benzoxazole-2,5-diamine |
| SMILES | Nc1ccc2oc(NCc3ccc(F)c(F)c3)nc2c1 |
| InChI | InChI=1S/C14H11F2N3O/c15-10-3-1-8(5-11(10)16)7-18-14-19-12-6-9(17)2-4-13(12)20-14/h1-6H,7,17H2,(H,18,19) |
| InChIKey | HSPCHLRACQKETJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|