C10H18N6S2 — CID 113489654
4-N-(1,4-dithian-2-ylmethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 113489654) has the molecular formula C10H18N6S2 and a molecular weight of 286.43 g/mol. Its IUPAC name is 4-N-(1,4-dithian-2-ylmethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(1,4-dithian-2-ylmethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 113489654 |
| Molecular Formula | C10H18N6S2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-N-(1,4-dithian-2-ylmethyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N)nc(NCC2CSCCS2)n1 |
| InChI | InChI=1S/C10H18N6S2/c1-16(2)10-14-8(11)13-9(15-10)12-5-7-6-17-3-4-18-7/h7H,3-6H2,1-2H3,(H3,11,12,13,14,15) |
| InChIKey | NXHKTXKTRKMPMP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |