C12H22N12 — CID 130243747
4-N-[2-[[4,6-bis(methylamino)-1,3,5-triazin-2-yl]amino]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 130243747) has the molecular formula C12H22N12 and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-N-[2-[[4,6-bis(methylamino)-1,3,5-triazin-2-yl]amino]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[2-[[4,6-bis(methylamino)-1,3,5-triazin-2-yl]amino]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 130243747 |
| Molecular Formula | C12H22N12 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 4-N-[2-[[4,6-bis(methylamino)-1,3,5-triazin-2-yl]amino]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NC)nc(NCCNc2nc(N)nc(N(C)C)n2)n1 |
| InChI | InChI=1S/C12H22N12/c1-14-8-20-9(15-2)22-11(21-8)17-6-5-16-10-18-7(13)19-12(23-10)24(3)4/h5-6H2,1-4H3,(H3,13,16,18,19,23)(H3,14,15,17,20,21,22) |
| InChIKey | DOXGCJYDGJGNJW-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|