C25H51ClN14 — CID 45264890
4-N-[3-[9-[3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]propylamino]nonylamino]propyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine;hydrochloride (PubChem CID 45264890) has the molecular formula C25H51ClN14 and a molecular weight of 583.23 g/mol. Its IUPAC name is 4-N-[3-[9-[3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]propylamino]nonylamino]propyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine;hydrochloride.
| Compound Name | 4-N-[3-[9-[3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]propylamino]nonylamino]propyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine;hydrochloride |
|---|---|
| PubChem CID | 45264890 |
| Molecular Formula | C25H51ClN14 |
| Molecular Weight | 583.23 g/mol |
| Exact Mass | 582.41 |
| IUPAC Name | 4-N-[3-[9-[3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]propylamino]nonylamino]propyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine;hydrochloride |
| SMILES | CN(C)c1nc(N)nc(NCCCNCCCCCCCCCNCCCNc2nc(N)nc(N(C)C)n2)n1.Cl |
| InChI | InChI=1S/C25H50N14.ClH/c1-38(2)24-34-20(26)32-22(36-24)30-18-12-16-28-14-10-8-6-5-7-9-11-15-29-17-13-19-31-23-33-21(27)35-25(37-23)39(3)4;/h28-29H,5-19H2,1-4H3,(H3,26,30,32,34,36)(H3,27,31,33,35,37);1H |
| InChIKey | OXZXPDPLCZCIDH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 183.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|