C14H28N6 — CID 80852626
4-N-(2,2-dimethylheptyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80852626) has the molecular formula C14H28N6 and a molecular weight of 280.42 g/mol. Its IUPAC name is 4-N-(2,2-dimethylheptyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2,2-dimethylheptyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80852626 |
| Molecular Formula | C14H28N6 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 4-N-(2,2-dimethylheptyl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCC(C)(C)CNc1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H28N6/c1-6-7-8-9-14(2,3)10-16-12-17-11(15)18-13(19-12)20(4)5/h6-10H2,1-5H3,(H3,15,16,17,18,19) |
| InChIKey | NPEJRTFJIUVMIC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|