C14H29N7 — CID 80771087
4-N-[3-(dimethylamino)-2,2-dimethylpropyl]-6-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80771087) has the molecular formula C14H29N7 and a molecular weight of 295.44 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)-2,2-dimethylpropyl]-6-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[3-(dimethylamino)-2,2-dimethylpropyl]-6-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80771087 |
| Molecular Formula | C14H29N7 |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | 4-N-[3-(dimethylamino)-2,2-dimethylpropyl]-6-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCC(C)(C)CN(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H29N7/c1-8-15-11-17-12(19-13(18-11)21(6)7)16-9-14(2,3)10-20(4)5/h8-10H2,1-7H3,(H2,15,16,17,18,19) |
| InChIKey | SSNGXHKUZMTTHJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |