C9H19N7 — CID 83027111
6-(2,2-dimethylhydrazinyl)-2-N-ethyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 83027111) has the molecular formula C9H19N7 and a molecular weight of 225.30 g/mol. Its IUPAC name is 6-(2,2-dimethylhydrazinyl)-2-N-ethyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,2-dimethylhydrazinyl)-2-N-ethyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 83027111 |
| Molecular Formula | C9H19N7 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 6-(2,2-dimethylhydrazinyl)-2-N-ethyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(NN(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C9H19N7/c1-6-10-7-11-8(14-16(4)5)13-9(12-7)15(2)3/h6H2,1-5H3,(H2,10,11,12,13,14) |
| InChIKey | NYNRPSKLDISFES-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|