C13H25N5O — CID 80861351
2-N,2-N-dimethyl-6-octoxy-1,3,5-triazine-2,4-diamine (PubChem CID 80861351) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-octoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-octoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80861351 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 2-N,2-N-dimethyl-6-octoxy-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCOc1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H25N5O/c1-4-5-6-7-8-9-10-19-13-16-11(14)15-12(17-13)18(2)3/h4-10H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | COHTZCXYFBRANP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|