C9H15ClN4O — CID 80861147
4-chloro-6-hexoxy-1,3,5-triazin-2-amine (PubChem CID 80861147) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is 4-chloro-6-hexoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-hexoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80861147 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-chloro-6-hexoxy-1,3,5-triazin-2-amine |
| SMILES | CCCCCCOc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C9H15ClN4O/c1-2-3-4-5-6-15-9-13-7(10)12-8(11)14-9/h2-6H2,1H3,(H2,11,12,13,14) |
| InChIKey | XONFCVDAAGLJNV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|