C11H18ClN3O2 — CID 62857809
2-chloro-4-heptoxy-6-methoxy-1,3,5-triazine (PubChem CID 62857809) has the molecular formula C11H18ClN3O2 and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-chloro-4-heptoxy-6-methoxy-1,3,5-triazine.
| Compound Name | 2-chloro-4-heptoxy-6-methoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 62857809 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-chloro-4-heptoxy-6-methoxy-1,3,5-triazine |
| SMILES | CCCCCCCOc1nc(Cl)nc(OC)n1 |
| InChI | InChI=1S/C11H18ClN3O2/c1-3-4-5-6-7-8-17-11-14-9(12)13-10(15-11)16-2/h3-8H2,1-2H3 |
| InChIKey | AKBMIWVZBKLFSF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|