C9H14ClN3O3 — CID 62870657
3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)oxy]propan-1-ol (PubChem CID 62870657) has the molecular formula C9H14ClN3O3 and a molecular weight of 247.68 g/mol. Its IUPAC name is 3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)oxy]propan-1-ol.
| Compound Name | 3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)oxy]propan-1-ol |
|---|---|
| PubChem CID | 62870657 |
| Molecular Formula | C9H14ClN3O3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)oxy]propan-1-ol |
| SMILES | CCCOc1nc(Cl)nc(OCCCO)n1 |
| InChI | InChI=1S/C9H14ClN3O3/c1-2-5-15-8-11-7(10)12-9(13-8)16-6-3-4-14/h14H,2-6H2,1H3 |
| InChIKey | CIJCXXOXZDGTFT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|