C5H5Cl2N3O2 — CID 62859409
2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethanol (PubChem CID 62859409) has the molecular formula C5H5Cl2N3O2 and a molecular weight of 210.02 g/mol. Its IUPAC name is 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethanol.
| Compound Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethanol |
|---|---|
| PubChem CID | 62859409 |
| Molecular Formula | C5H5Cl2N3O2 |
| Molecular Weight | 210.02 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]ethanol |
| SMILES | OCCOc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C5H5Cl2N3O2/c6-3-8-4(7)10-5(9-3)12-2-1-11/h11H,1-2H2 |
| InChIKey | VEGXQQCJJBOGRY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.02 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |