C11H19ClN4O2 — CID 62870340
3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)oxy]-N,N-dimethylpropan-1-amine (PubChem CID 62870340) has the molecular formula C11H19ClN4O2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 62870340 |
| Molecular Formula | C11H19ClN4O2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)oxy]-N,N-dimethylpropan-1-amine |
| SMILES | CCCOc1nc(Cl)nc(OCCCN(C)C)n1 |
| InChI | InChI=1S/C11H19ClN4O2/c1-4-7-17-10-13-9(12)14-11(15-10)18-8-5-6-16(2)3/h4-8H2,1-3H3 |
| InChIKey | QTAHATJUTITWAS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|