C10H18ClN5O — CID 80871228
4-chloro-6-[3-(dimethylamino)propoxy]-N-ethyl-1,3,5-triazin-2-amine (PubChem CID 80871228) has the molecular formula C10H18ClN5O and a molecular weight of 259.74 g/mol. Its IUPAC name is 4-chloro-6-[3-(dimethylamino)propoxy]-N-ethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-[3-(dimethylamino)propoxy]-N-ethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80871228 |
| Molecular Formula | C10H18ClN5O |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-chloro-6-[3-(dimethylamino)propoxy]-N-ethyl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(Cl)nc(OCCCN(C)C)n1 |
| InChI | InChI=1S/C10H18ClN5O/c1-4-12-9-13-8(11)14-10(15-9)17-7-5-6-16(2)3/h4-7H2,1-3H3,(H,12,13,14,15) |
| InChIKey | NRTSZTRBAWXMJB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|