C13H23ClN4O — CID 80862197
4-chloro-N-ethyl-6-octoxy-1,3,5-triazin-2-amine (PubChem CID 80862197) has the molecular formula C13H23ClN4O and a molecular weight of 286.81 g/mol. Its IUPAC name is 4-chloro-N-ethyl-6-octoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-ethyl-6-octoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80862197 |
| Molecular Formula | C13H23ClN4O |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 4-chloro-N-ethyl-6-octoxy-1,3,5-triazin-2-amine |
| SMILES | CCCCCCCCOc1nc(Cl)nc(NCC)n1 |
| InChI | InChI=1S/C13H23ClN4O/c1-3-5-6-7-8-9-10-19-13-17-11(14)16-12(18-13)15-4-2/h3-10H2,1-2H3,(H,15,16,17,18) |
| InChIKey | QNEYQJPEMXGSJS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|