C15H27N5O — CID 80842497
N-ethyl-4-hexoxy-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80842497) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is N-ethyl-4-hexoxy-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-hexoxy-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80842497 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | N-ethyl-4-hexoxy-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCCCCCOc1nc(NCC)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C15H27N5O/c1-3-5-6-9-12-21-15-18-13(16-4-2)17-14(19-15)20-10-7-8-11-20/h3-12H2,1-2H3,(H,16,17,18,19) |
| InChIKey | FBDNECLXCZJBNM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|