C11H19N5O — CID 80767228
4-ethoxy-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80767228) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80767228 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 4-ethoxy-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(OCC)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C11H19N5O/c1-3-12-9-13-10(16-7-5-6-8-16)15-11(14-9)17-4-2/h3-8H2,1-2H3,(H,12,13,14,15) |
| InChIKey | KGXWKMPOAHNNHL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |