C9H16N6 — CID 80770376
2-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80770376) has the molecular formula C9H16N6 and a molecular weight of 208.27 g/mol. Its IUPAC name is 2-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80770376 |
| Molecular Formula | C9H16N6 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-N-ethyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(N)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C9H16N6/c1-2-11-8-12-7(10)13-9(14-8)15-5-3-4-6-15/h2-6H2,1H3,(H3,10,11,12,13,14) |
| InChIKey | BGLWWQOFYJPVCN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |