C10H19N7 — CID 80932196
N-ethyl-4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80932196) has the molecular formula C10H19N7 and a molecular weight of 237.31 g/mol. Its IUPAC name is N-ethyl-4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80932196 |
| Molecular Formula | C10H19N7 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-ethyl-4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(NN)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C10H19N7/c1-2-12-8-13-9(16-11)15-10(14-8)17-6-4-3-5-7-17/h2-7,11H2,1H3,(H2,12,13,14,15,16) |
| InChIKey | UBXMGYPDKIADEG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|