C9H17N7O — CID 34253082
N-ethyl-4-hydrazinyl-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 34253082) has the molecular formula C9H17N7O and a molecular weight of 239.28 g/mol. Its IUPAC name is N-ethyl-4-hydrazinyl-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-hydrazinyl-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 34253082 |
| Molecular Formula | C9H17N7O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-ethyl-4-hydrazinyl-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(NN)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H17N7O/c1-2-11-7-12-8(15-10)14-9(13-7)16-3-5-17-6-4-16/h2-6,10H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | DHBVRQVHXJBMDQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|