C11H21N7O — CID 80942778
3-[(4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol (PubChem CID 80942778) has the molecular formula C11H21N7O and a molecular weight of 267.34 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol.
| Compound Name | 3-[(4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 80942778 |
| Molecular Formula | C11H21N7O |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 3-[(4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol |
| SMILES | NNc1nc(NCCCO)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C11H21N7O/c12-17-10-14-9(13-5-4-8-19)15-11(16-10)18-6-2-1-3-7-18/h19H,1-8,12H2,(H2,13,14,15,16,17) |
| InChIKey | LFFAGCLZAVBJGV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|