C13H25N7O — CID 80929099
3-[[(4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]methyl]pentan-1-ol (PubChem CID 80929099) has the molecular formula C13H25N7O and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-[[(4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]methyl]pentan-1-ol.
| Compound Name | 3-[[(4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]methyl]pentan-1-ol |
|---|---|
| PubChem CID | 80929099 |
| Molecular Formula | C13H25N7O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 3-[[(4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]methyl]pentan-1-ol |
| SMILES | CCC(CCO)CNc1nc(NN)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H25N7O/c1-2-10(5-8-21)9-15-11-16-12(19-14)18-13(17-11)20-6-3-4-7-20/h10,21H,2-9,14H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | TXECWWZSDFWALJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|