C10H20N8O2S — CID 80900517
3-[(4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]propane-1-sulfonamide (PubChem CID 80900517) has the molecular formula C10H20N8O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 80900517 |
| Molecular Formula | C10H20N8O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-[(4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]propane-1-sulfonamide |
| SMILES | NNc1nc(NCCCS(N)(=O)=O)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C10H20N8O2S/c11-17-9-14-8(13-4-3-7-21(12,19)20)15-10(16-9)18-5-1-2-6-18/h1-7,11H2,(H2,12,19,20)(H2,13,14,15,16,17) |
| InChIKey | YYYBJBLKFLLNQK-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 152.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|