C14H24N12 — CID 139460803
2-N-[4-[(4-amino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]butyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 139460803) has the molecular formula C14H24N12 and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-N-[4-[(4-amino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]butyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[4-[(4-amino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]butyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 139460803 |
| Molecular Formula | C14H24N12 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-N-[4-[(4-amino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]butyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(NCCCCNc2nc(N)nc(N3CCCC3)n2)n1 |
| InChI | InChI=1S/C14H24N12/c15-9-20-10(16)22-12(21-9)18-5-1-2-6-19-13-23-11(17)24-14(25-13)26-7-3-4-8-26/h1-8H2,(H3,17,19,23,24,25)(H5,15,16,18,20,21,22) |
| InChIKey | SFFKOCJCKKPXBL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 182.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|