C28H46N12 — CID 15333325
N,N'-bis[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]ethane-1,2-diamine (PubChem CID 15333325) has the molecular formula C28H46N12 and a molecular weight of 550.76 g/mol. Its IUPAC name is N,N'-bis[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 15333325 |
| Molecular Formula | C28H46N12 |
| Molecular Weight | 550.76 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | N,N'-bis[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]ethane-1,2-diamine |
| SMILES | C1CCN(c2nc(NCCNc3nc(N4CCCCC4)nc(N4CCCCC4)n3)nc(N3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C28H46N12/c1-5-15-37(16-6-1)25-31-23(32-26(35-25)38-17-7-2-8-18-38)29-13-14-30-24-33-27(39-19-9-3-10-20-39)36-28(34-24)40-21-11-4-12-22-40/h1-22H2,(H,29,31,32,35)(H,30,33,34,36) |
| InChIKey | FTSCDGQGZFANLD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 114.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|