C11H20N8O2 — CID 83206301
2-[(4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]ethyl carbamate (PubChem CID 83206301) has the molecular formula C11H20N8O2 and a molecular weight of 296.34 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]ethyl carbamate.
| Compound Name | 2-[(4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83206301 |
| Molecular Formula | C11H20N8O2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[(4-hydrazinyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]ethyl carbamate |
| SMILES | NNc1nc(NCCOC(N)=O)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C11H20N8O2/c12-8(20)21-7-4-14-9-15-10(18-13)17-11(16-9)19-5-2-1-3-6-19/h1-7,13H2,(H2,12,20)(H2,14,15,16,17,18) |
| InChIKey | CQSZUDQHDBFGPI-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|