C15H25N5O — CID 80844670
4-cyclopentyloxy-N-ethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80844670) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-ethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclopentyloxy-N-ethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80844670 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 4-cyclopentyloxy-N-ethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(OC2CCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C15H25N5O/c1-2-16-13-17-14(20-10-6-3-7-11-20)19-15(18-13)21-12-8-4-5-9-12/h12H,2-11H2,1H3,(H,16,17,18,19) |
| InChIKey | QTBHUBLHIOMDGQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |