C14H21N5O — CID 106795533
4-but-3-ynoxy-N-propyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 106795533) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-but-3-ynoxy-N-propyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-but-3-ynoxy-N-propyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106795533 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-but-3-ynoxy-N-propyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | C#CCCOc1nc(NCCC)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C14H21N5O/c1-3-5-11-20-14-17-12(15-8-4-2)16-13(18-14)19-9-6-7-10-19/h1H,4-11H2,2H3,(H,15,16,17,18) |
| InChIKey | QDLRZCLIXJGNPU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|