C11H19N5O2 — CID 80766525
4-methoxy-6-morpholin-4-yl-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80766525) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-methoxy-6-morpholin-4-yl-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-morpholin-4-yl-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80766525 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-methoxy-6-morpholin-4-yl-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(OC)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H19N5O2/c1-3-4-12-9-13-10(15-11(14-9)17-2)16-5-7-18-8-6-16/h3-8H2,1-2H3,(H,12,13,14,15) |
| InChIKey | AXRSUZJHLYFSTO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |