C14H26ClN5O — CID 62862613
N-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine (PubChem CID 62862613) has the molecular formula C14H26ClN5O and a molecular weight of 315.85 g/mol. Its IUPAC name is N-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine.
| Compound Name | N-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 62862613 |
| Molecular Formula | C14H26ClN5O |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
| SMILES | CCCOc1nc(Cl)nc(NCCCCN(C)C(C)C)n1 |
| InChI | InChI=1S/C14H26ClN5O/c1-5-10-21-14-18-12(15)17-13(19-14)16-8-6-7-9-20(4)11(2)3/h11H,5-10H2,1-4H3,(H,16,17,18,19) |
| InChIKey | LSWKBQBVCHFNRY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|