C9H16ClN5O3S — CID 62862604
3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)amino]propane-1-sulfonamide (PubChem CID 62862604) has the molecular formula C9H16ClN5O3S and a molecular weight of 309.78 g/mol. Its IUPAC name is 3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 62862604 |
| Molecular Formula | C9H16ClN5O3S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)amino]propane-1-sulfonamide |
| SMILES | CCCOc1nc(Cl)nc(NCCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C9H16ClN5O3S/c1-2-5-18-9-14-7(10)13-8(15-9)12-4-3-6-19(11,16)17/h2-6H2,1H3,(H2,11,16,17)(H,12,13,14,15) |
| InChIKey | BVXFYGKZDZXZST-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|