C10H21N7O3S — CID 106332444
N-[3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]propyl]methanesulfonamide (PubChem CID 106332444) has the molecular formula C10H21N7O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106332444 |
| Molecular Formula | C10H21N7O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]propyl]methanesulfonamide |
| SMILES | CCCOc1nc(NN)nc(NCCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H21N7O3S/c1-3-7-20-10-15-8(14-9(16-10)17-11)12-5-4-6-13-21(2,18)19/h13H,3-7,11H2,1-2H3,(H2,12,14,15,16,17) |
| InChIKey | ARBRVDDKABEPNN-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 144.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|