C12H22N4O3S — CID 106337209
N-[3-[(4-methyl-6-propoxypyrimidin-2-yl)amino]propyl]methanesulfonamide (PubChem CID 106337209) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[3-[(4-methyl-6-propoxypyrimidin-2-yl)amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(4-methyl-6-propoxypyrimidin-2-yl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106337209 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[3-[(4-methyl-6-propoxypyrimidin-2-yl)amino]propyl]methanesulfonamide |
| SMILES | CCCOc1cc(C)nc(NCCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C12H22N4O3S/c1-4-8-19-11-9-10(2)15-12(16-11)13-6-5-7-14-20(3,17)18/h9,14H,4-8H2,1-3H3,(H,13,15,16) |
| InChIKey | CIVSCVCLFAWBHS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|