C16H21N3OS — CID 115974555
4-methyl-N-(2-phenylsulfanylethyl)-6-propoxypyrimidin-2-amine (PubChem CID 115974555) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-methyl-N-(2-phenylsulfanylethyl)-6-propoxypyrimidin-2-amine.
| Compound Name | 4-methyl-N-(2-phenylsulfanylethyl)-6-propoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 115974555 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-methyl-N-(2-phenylsulfanylethyl)-6-propoxypyrimidin-2-amine |
| SMILES | CCCOc1cc(C)nc(NCCSc2ccccc2)n1 |
| InChI | InChI=1S/C16H21N3OS/c1-3-10-20-15-12-13(2)18-16(19-15)17-9-11-21-14-7-5-4-6-8-14/h4-8,12H,3,9-11H2,1-2H3,(H,17,18,19) |
| InChIKey | QRNMWGYJYHPTKQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|