C10H20N6O3 — CID 80922470
3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]-2-methylpropane-1,2-diol (PubChem CID 80922470) has the molecular formula C10H20N6O3 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]-2-methylpropane-1,2-diol.
| Compound Name | 3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 80922470 |
| Molecular Formula | C10H20N6O3 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]-2-methylpropane-1,2-diol |
| SMILES | CCCOc1nc(NN)nc(NCC(C)(O)CO)n1 |
| InChI | InChI=1S/C10H20N6O3/c1-3-4-19-9-14-7(13-8(15-9)16-11)12-5-10(2,18)6-17/h17-18H,3-6,11H2,1-2H3,(H2,12,13,14,15,16) |
| InChIKey | CMCREJXFEVAOLI-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|