C11H22N6O — CID 103466753
N-(2,2-dimethylbutyl)-4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-amine (PubChem CID 103466753) has the molecular formula C11H22N6O and a molecular weight of 254.34 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-amine.
| Compound Name | N-(2,2-dimethylbutyl)-4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103466753 |
| Molecular Formula | C11H22N6O |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | N-(2,2-dimethylbutyl)-4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(NN)nc(NCC(C)(C)CC)n1 |
| InChI | InChI=1S/C11H22N6O/c1-5-11(3,4)7-13-8-14-9(17-12)16-10(15-8)18-6-2/h5-7,12H2,1-4H3,(H2,13,14,15,16,17) |
| InChIKey | KWCLZQCYIYNEFS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|