C7H13N7O2 — CID 80932009
2-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]acetamide (PubChem CID 80932009) has the molecular formula C7H13N7O2 and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]acetamide.
| Compound Name | 2-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 80932009 |
| Molecular Formula | C7H13N7O2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]acetamide |
| SMILES | CCOc1nc(NN)nc(NCC(N)=O)n1 |
| InChI | InChI=1S/C7H13N7O2/c1-2-16-7-12-5(10-3-4(8)15)11-6(13-7)14-9/h2-3,9H2,1H3,(H2,8,15)(H2,10,11,12,13,14) |
| InChIKey | VEEHBBMSRPFKBJ-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 141.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|