C10H21N7O — CID 80943903
N-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 80943903) has the molecular formula C10H21N7O and a molecular weight of 255.33 g/mol. Its IUPAC name is N-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 80943903 |
| Molecular Formula | C10H21N7O |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCOc1nc(NN)nc(NCCCN(C)C)n1 |
| InChI | InChI=1S/C10H21N7O/c1-4-18-10-14-8(13-9(15-10)16-11)12-6-5-7-17(2)3/h4-7,11H2,1-3H3,(H2,12,13,14,15,16) |
| InChIKey | YJTPCQBYBKAUDP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|